C28H26N6O5S — CID 133243722
2-methoxy-N-[2-methoxy-5-[5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide (PubChem CID 133243722) has the molecular formula C28H26N6O5S and a molecular weight of 558.62 g/mol. Its IUPAC name is 2-methoxy-N-[2-methoxy-5-[5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide.
| Compound Name | 2-methoxy-N-[2-methoxy-5-[5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 133243722 |
| Molecular Formula | C28H26N6O5S |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 2-methoxy-N-[2-methoxy-5-[5-[1-(4-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
| SMILES | COCC(=O)Nc1cc(N2C(=S)NC(c3ccccn3)C2c2cccn2-c2ccc([N+](=O)[O-])cc2)ccc1OC |
| InChI | InChI=1S/C28H26N6O5S/c1-38-17-25(35)30-22-16-20(12-13-24(22)39-2)33-27(26(31-28(33)40)21-6-3-4-14-29-21)23-7-5-15-32(23)18-8-10-19(11-9-18)34(36)37/h3-16,26-27H,17H2,1-2H3,(H,30,35)(H,31,40) |
| InChIKey | UXUOTWRFFLMLFF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|