C28H26N6O4S — CID 100582843
2-methoxy-N-[2-methyl-4-[(4S,5S)-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide (PubChem CID 100582843) has the molecular formula C28H26N6O4S and a molecular weight of 542.62 g/mol. Its IUPAC name is 2-methoxy-N-[2-methyl-4-[(4S,5S)-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide.
| Compound Name | 2-methoxy-N-[2-methyl-4-[(4S,5S)-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 100582843 |
| Molecular Formula | C28H26N6O4S |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 2-methoxy-N-[2-methyl-4-[(4S,5S)-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
| SMILES | COCC(=O)Nc1ccc(N2C(=S)N[C@H](c3ccccn3)[C@H]2c2cccn2-c2cccc([N+](=O)[O-])c2)cc1C |
| InChI | InChI=1S/C28H26N6O4S/c1-18-15-20(11-12-22(18)30-25(35)17-38-2)33-27(26(31-28(33)39)23-9-3-4-13-29-23)24-10-6-14-32(24)19-7-5-8-21(16-19)34(36)37/h3-16,26-27H,17H2,1-2H3,(H,30,35)(H,31,39)/t26-,27-/m1/s1 |
| InChIKey | PKEQWTDUBPTYGD-KAYWLYCHSA-N |
| XLogP | 4.85 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|