C32H26N6O4S — CID 100538810
N-[4-[(4S,5R)-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide (PubChem CID 100538810) has the molecular formula C32H26N6O4S and a molecular weight of 590.67 g/mol. Its IUPAC name is N-[4-[(4S,5R)-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide.
| Compound Name | N-[4-[(4S,5R)-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 100538810 |
| Molecular Formula | C32H26N6O4S |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | N-[4-[(4S,5R)-5-[1-(3-nitrophenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)Nc1ccc(N2C(=S)N[C@H](c3ccccn3)[C@@H]2c2cccn2-c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C32H26N6O4S/c39-29(21-42-26-10-2-1-3-11-26)34-22-14-16-23(17-15-22)37-31(30(35-32(37)43)27-12-4-5-18-33-27)28-13-7-19-36(28)24-8-6-9-25(20-24)38(40)41/h1-20,30-31H,21H2,(H,34,39)(H,35,43)/t30-,31+/m1/s1 |
| InChIKey | YDXPBYCFAPUJBN-JSOSNVBQSA-N |
| XLogP | 5.98 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|