C32H25N5O5S — CID 100540522
N-[4-[(4R,5R)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide (PubChem CID 100540522) has the molecular formula C32H25N5O5S and a molecular weight of 591.65 g/mol. Its IUPAC name is N-[4-[(4R,5R)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide.
| Compound Name | N-[4-[(4R,5R)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 100540522 |
| Molecular Formula | C32H25N5O5S |
| Molecular Weight | 591.65 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | N-[4-[(4R,5R)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)Nc1ccc(N2C(=S)N[C@@H](c3ccccn3)[C@@H]2c2ccc(-c3cccc([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C32H25N5O5S/c38-29(20-41-25-9-2-1-3-10-25)34-22-12-14-23(15-13-22)36-31(30(35-32(36)43)26-11-4-5-18-33-26)28-17-16-27(42-28)21-7-6-8-24(19-21)37(39)40/h1-19,30-31H,20H2,(H,34,38)(H,35,43)/t30-,31-/m0/s1 |
| InChIKey | GOFHAFLBMUVVIC-CONSDPRKSA-N |
| XLogP | 6.44 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.65 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|