C32H24Cl2N4O3S — CID 100539565
N-[4-[(4S,5R)-5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide (PubChem CID 100539565) has the molecular formula C32H24Cl2N4O3S and a molecular weight of 615.54 g/mol. Its IUPAC name is N-[4-[(4S,5R)-5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide.
| Compound Name | N-[4-[(4S,5R)-5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 100539565 |
| Molecular Formula | C32H24Cl2N4O3S |
| Molecular Weight | 615.54 g/mol |
| Exact Mass | 614.09 |
| IUPAC Name | N-[4-[(4S,5R)-5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)Nc1ccc(N2C(=S)N[C@H](c3ccccn3)[C@@H]2c2ccc(-c3ccc(Cl)c(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C32H24Cl2N4O3S/c33-24-14-9-20(18-25(24)34)27-15-16-28(41-27)31-30(26-8-4-5-17-35-26)37-32(42)38(31)22-12-10-21(11-13-22)36-29(39)19-40-23-6-2-1-3-7-23/h1-18,30-31H,19H2,(H,36,39)(H,37,42)/t30-,31+/m1/s1 |
| InChIKey | HAQZPAAYRYJDBP-JSOSNVBQSA-N |
| XLogP | 7.84 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.54 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|