C28H24Cl2N4O2S — CID 133242854
N-[4-[5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide (PubChem CID 133242854) has the molecular formula C28H24Cl2N4O2S and a molecular weight of 551.50 g/mol. Its IUPAC name is N-[4-[5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide.
| Compound Name | N-[4-[5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide |
|---|---|
| PubChem CID | 133242854 |
| Molecular Formula | C28H24Cl2N4O2S |
| Molecular Weight | 551.50 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | N-[4-[5-[5-(3,4-dichlorophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(-c3ccc(Cl)c(Cl)c3)o2)cc1C |
| InChI | InChI=1S/C28H24Cl2N4O2S/c1-3-25(35)32-21-10-8-18(14-16(21)2)34-27(26(33-28(34)37)22-6-4-5-13-31-22)24-12-11-23(36-24)17-7-9-19(29)20(30)15-17/h4-15,26-27H,3H2,1-2H3,(H,32,35)(H,33,37) |
| InChIKey | AZXVFTZQUOQYNR-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.50 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|