C28H25N5O4S — CID 100559538
N-[2-methyl-4-[(4S,5S)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]propanamide (PubChem CID 100559538) has the molecular formula C28H25N5O4S and a molecular weight of 527.61 g/mol. Its IUPAC name is N-[2-methyl-4-[(4S,5S)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]propanamide.
| Compound Name | N-[2-methyl-4-[(4S,5S)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 100559538 |
| Molecular Formula | C28H25N5O4S |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | N-[2-methyl-4-[(4S,5S)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(N2C(=S)N[C@H](c3ccccn3)[C@H]2c2ccc(-c3cccc([N+](=O)[O-])c3)o2)cc1C |
| InChI | InChI=1S/C28H25N5O4S/c1-3-25(34)30-21-11-10-19(15-17(21)2)32-27(26(31-28(32)38)22-9-4-5-14-29-22)24-13-12-23(37-24)18-7-6-8-20(16-18)33(35)36/h4-16,26-27H,3H2,1-2H3,(H,30,34)(H,31,38)/t26-,27-/m1/s1 |
| InChIKey | JCHWLXBITAYJIK-KAYWLYCHSA-N |
| XLogP | 6.08 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|