C29H27N5O5S — CID 100558906
N-[4-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide (PubChem CID 100558906) has the molecular formula C29H27N5O5S and a molecular weight of 557.63 g/mol. Its IUPAC name is N-[4-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide.
| Compound Name | N-[4-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide |
|---|---|
| PubChem CID | 100558906 |
| Molecular Formula | C29H27N5O5S |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | N-[4-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(N2C(=S)N[C@@H](c3ccccn3)[C@@H]2c2ccc(-c3ccc([N+](=O)[O-])cc3OC)o2)cc1C |
| InChI | InChI=1S/C29H27N5O5S/c1-4-26(35)31-21-11-9-18(15-17(21)2)33-28(27(32-29(33)40)22-7-5-6-14-30-22)24-13-12-23(39-24)20-10-8-19(34(36)37)16-25(20)38-3/h5-16,27-28H,4H2,1-3H3,(H,31,35)(H,32,40)/t27-,28-/m0/s1 |
| InChIKey | LWRQYQCDEXLDNE-NSOVKSMOSA-N |
| XLogP | 6.09 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|