C27H25N5O6S2 — CID 100644064
N-[4-[(4S,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]methanesulfonamide (PubChem CID 100644064) has the molecular formula C27H25N5O6S2 and a molecular weight of 579.66 g/mol. Its IUPAC name is N-[4-[(4S,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]methanesulfonamide.
| Compound Name | N-[4-[(4S,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 100644064 |
| Molecular Formula | C27H25N5O6S2 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | N-[4-[(4S,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-2-methylphenyl]methanesulfonamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc([C@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(NS(C)(=O)=O)c(C)c2)o1 |
| InChI | InChI=1S/C27H25N5O6S2/c1-16-14-17(8-10-20(16)30-40(3,35)36)31-26(25(29-27(31)39)21-6-4-5-13-28-21)23-12-11-22(38-23)19-9-7-18(32(33)34)15-24(19)37-2/h4-15,25-26,30H,1-3H3,(H,29,39)/t25-,26+/m1/s1 |
| InChIKey | ZHNNMLAIEIWKOU-FTJBHMTQSA-N |
| XLogP | 5.12 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|