C26H23N5O5S2 — CID 100645146
N-[2-methyl-4-[(4R,5R)-5-[5-(4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide (PubChem CID 100645146) has the molecular formula C26H23N5O5S2 and a molecular weight of 549.63 g/mol. Its IUPAC name is N-[2-methyl-4-[(4R,5R)-5-[5-(4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide.
| Compound Name | N-[2-methyl-4-[(4R,5R)-5-[5-(4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 100645146 |
| Molecular Formula | C26H23N5O5S2 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | N-[2-methyl-4-[(4R,5R)-5-[5-(4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]methanesulfonamide |
| SMILES | Cc1cc(N2C(=S)N[C@@H](c3ccccn3)[C@@H]2c2ccc(-c3ccc([N+](=O)[O-])cc3)o2)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C26H23N5O5S2/c1-16-15-19(10-11-20(16)29-38(2,34)35)30-25(24(28-26(30)37)21-5-3-4-14-27-21)23-13-12-22(36-23)17-6-8-18(9-7-17)31(32)33/h3-15,24-25,29H,1-2H3,(H,28,37)/t24-,25-/m0/s1 |
| InChIKey | LRCMUGUIGBVVFV-DQEYMECFSA-N |
| XLogP | 5.11 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|