C29H26ClN5O5S — CID 100552597
N-[2-chloro-4-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methylpropanamide (PubChem CID 100552597) has the molecular formula C29H26ClN5O5S and a molecular weight of 592.08 g/mol. Its IUPAC name is N-[2-chloro-4-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[2-chloro-4-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 100552597 |
| Molecular Formula | C29H26ClN5O5S |
| Molecular Weight | 592.08 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | N-[2-chloro-4-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-methylpropanamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc([C@H]2[C@H](c3ccccn3)NC(=S)N2c2ccc(NC(=O)C(C)C)c(Cl)c2)o1 |
| InChI | InChI=1S/C29H26ClN5O5S/c1-16(2)28(36)32-21-10-8-17(14-20(21)30)34-27(26(33-29(34)41)22-6-4-5-13-31-22)24-12-11-23(40-24)19-9-7-18(35(37)38)15-25(19)39-3/h4-16,26-27H,1-3H3,(H,32,36)(H,33,41)/t26-,27-/m0/s1 |
| InChIKey | MWZARBPZCNBAER-SVBPBHIXSA-N |
| XLogP | 6.68 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.08 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|