C31H31N5O6S — CID 100546242
N-[2-methoxy-4-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2,2-dimethylpropanamide (PubChem CID 100546242) has the molecular formula C31H31N5O6S and a molecular weight of 601.69 g/mol. Its IUPAC name is N-[2-methoxy-4-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-methoxy-4-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 100546242 |
| Molecular Formula | C31H31N5O6S |
| Molecular Weight | 601.69 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | N-[2-methoxy-4-[(4R,5R)-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2,2-dimethylpropanamide |
| SMILES | COc1cc(N2C(=S)N[C@@H](c3ccccn3)[C@@H]2c2ccc(-c3ccc([N+](=O)[O-])cc3OC)o2)ccc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C31H31N5O6S/c1-31(2,3)29(37)33-21-12-10-18(16-26(21)41-5)35-28(27(34-30(35)43)22-8-6-7-15-32-22)24-14-13-23(42-24)20-11-9-19(36(38)39)17-25(20)40-4/h6-17,27-28H,1-5H3,(H,33,37)(H,34,43)/t27-,28-/m0/s1 |
| InChIKey | QQBIQWIUZRASLU-NSOVKSMOSA-N |
| XLogP | 6.43 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.69 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|