C30H29N5O5S — CID 133242508
N-[2-methoxy-4-[5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2,2-dimethylpropanamide (PubChem CID 133242508) has the molecular formula C30H29N5O5S and a molecular weight of 571.66 g/mol. Its IUPAC name is N-[2-methoxy-4-[5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-methoxy-4-[5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 133242508 |
| Molecular Formula | C30H29N5O5S |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | N-[2-methoxy-4-[5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2,2-dimethylpropanamide |
| SMILES | COc1cc(N2C(=S)NC(c3ccccn3)C2c2ccc(-c3ccccc3[N+](=O)[O-])o2)ccc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C30H29N5O5S/c1-30(2,3)28(36)32-20-13-12-18(17-25(20)39-4)34-27(26(33-29(34)41)21-10-7-8-16-31-21)24-15-14-23(40-24)19-9-5-6-11-22(19)35(37)38/h5-17,26-27H,1-4H3,(H,32,36)(H,33,41) |
| InChIKey | XSIZIDYDNVCYID-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|