C31H30ClN5O4S — CID 100521467
(4S,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100521467) has the molecular formula C31H30ClN5O4S and a molecular weight of 604.13 g/mol. Its IUPAC name is (4S,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100521467 |
| Molecular Formula | C31H30ClN5O4S |
| Molecular Weight | 604.13 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | (4S,5R)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc([C@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(N3CCC(C)CC3)c(Cl)c2)o1 |
| InChI | InChI=1S/C31H30ClN5O4S/c1-19-12-15-35(16-13-19)25-9-7-20(17-23(25)32)36-30(29(34-31(36)42)24-5-3-4-14-33-24)27-11-10-26(41-27)22-8-6-21(37(38)39)18-28(22)40-2/h3-11,14,17-19,29-30H,12-13,15-16H2,1-2H3,(H,34,42)/t29-,30+/m1/s1 |
| InChIKey | IZACLTMSFJYWEC-IHLOFXLRSA-N |
| XLogP | 7.33 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.13 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|