C27H23N5O5S — CID 133243234
2-methoxy-N-[4-[5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide (PubChem CID 133243234) has the molecular formula C27H23N5O5S and a molecular weight of 529.58 g/mol. Its IUPAC name is 2-methoxy-N-[4-[5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide.
| Compound Name | 2-methoxy-N-[4-[5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 133243234 |
| Molecular Formula | C27H23N5O5S |
| Molecular Weight | 529.58 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 2-methoxy-N-[4-[5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
| SMILES | COCC(=O)Nc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(-c3cccc([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C27H23N5O5S/c1-36-16-24(33)29-18-8-10-19(11-9-18)31-26(25(30-27(31)38)21-7-2-3-14-28-21)23-13-12-22(37-23)17-5-4-6-20(15-17)32(34)35/h2-15,25-26H,16H2,1H3,(H,29,33)(H,30,38) |
| InChIKey | JHAQGYSJIFAOHA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|