C24H17ClN4O3S — CID 133182648
1-(4-chlorophenyl)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133182648) has the molecular formula C24H17ClN4O3S and a molecular weight of 476.95 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-chlorophenyl)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133182648 |
| Molecular Formula | C24H17ClN4O3S |
| Molecular Weight | 476.95 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[5-(3-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | O=[N+]([O-])c1cccc(-c2ccc(C3C(c4ccccn4)NC(=S)N3c3ccc(Cl)cc3)o2)c1 |
| InChI | InChI=1S/C24H17ClN4O3S/c25-16-7-9-17(10-8-16)28-23(22(27-24(28)33)19-6-1-2-13-26-19)21-12-11-20(32-21)15-4-3-5-18(14-15)29(30)31/h1-14,22-23H,(H,27,33) |
| InChIKey | LCIBJRSBXOMSRL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.95 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|