C34H28N4O5S — CID 100540658
methyl 3-[5-[(4R,5R)-3-[4-[(2-phenoxyacetyl)amino]phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate (PubChem CID 100540658) has the molecular formula C34H28N4O5S and a molecular weight of 604.69 g/mol. Its IUPAC name is methyl 3-[5-[(4R,5R)-3-[4-[(2-phenoxyacetyl)amino]phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate.
| Compound Name | methyl 3-[5-[(4R,5R)-3-[4-[(2-phenoxyacetyl)amino]phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 100540658 |
| Molecular Formula | C34H28N4O5S |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | methyl 3-[5-[(4R,5R)-3-[4-[(2-phenoxyacetyl)amino]phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc([C@H]3[C@H](c4ccccn4)NC(=S)N3c3ccc(NC(=O)COc4ccccc4)cc3)o2)c1 |
| InChI | InChI=1S/C34H28N4O5S/c1-41-33(40)23-9-7-8-22(20-23)28-17-18-29(43-28)32-31(27-12-5-6-19-35-27)37-34(44)38(32)25-15-13-24(14-16-25)36-30(39)21-42-26-10-3-2-4-11-26/h2-20,31-32H,21H2,1H3,(H,36,39)(H,37,44)/t31-,32-/m0/s1 |
| InChIKey | JACXGYQUYKWKAZ-ACHIHNKUSA-N |
| XLogP | 6.32 |
| TPSA | 105.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|