C31H29N3O4S — CID 100610501
methyl 3-[5-[(4R,5R)-3-(4-cyclopentyloxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate (PubChem CID 100610501) has the molecular formula C31H29N3O4S and a molecular weight of 539.66 g/mol. Its IUPAC name is methyl 3-[5-[(4R,5R)-3-(4-cyclopentyloxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate.
| Compound Name | methyl 3-[5-[(4R,5R)-3-(4-cyclopentyloxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 100610501 |
| Molecular Formula | C31H29N3O4S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | methyl 3-[5-[(4R,5R)-3-(4-cyclopentyloxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc([C@H]3[C@H](c4ccccn4)NC(=S)N3c3ccc(OC4CCCC4)cc3)o2)c1 |
| InChI | InChI=1S/C31H29N3O4S/c1-36-30(35)21-8-6-7-20(19-21)26-16-17-27(38-26)29-28(25-11-4-5-18-32-25)33-31(39)34(29)22-12-14-24(15-13-22)37-23-9-2-3-10-23/h4-8,11-19,23,28-29H,2-3,9-10H2,1H3,(H,33,39)/t28-,29-/m0/s1 |
| InChIKey | WQDVRIMTQHQKME-VMPREFPWSA-N |
| XLogP | 6.63 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|