C27H21N3O6S — CID 133156074
5-[5-[3-(4-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzene-1,3-dicarboxylic acid (PubChem CID 133156074) has the molecular formula C27H21N3O6S and a molecular weight of 515.55 g/mol. Its IUPAC name is 5-[5-[3-(4-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[5-[3-(4-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 133156074 |
| Molecular Formula | C27H21N3O6S |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | 5-[5-[3-(4-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzene-1,3-dicarboxylic acid |
| SMILES | COc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(-c3cc(C(=O)O)cc(C(=O)O)c3)o2)cc1 |
| InChI | InChI=1S/C27H21N3O6S/c1-35-19-7-5-18(6-8-19)30-24(23(29-27(30)37)20-4-2-3-11-28-20)22-10-9-21(36-22)15-12-16(25(31)32)14-17(13-15)26(33)34/h2-14,23-24H,1H3,(H,29,37)(H,31,32)(H,33,34) |
| InChIKey | LPIHBYKJFRPHEK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|