C32H25N3O5S — CID 133183975
2-[5-[3-[4-(4-methoxyphenoxy)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid (PubChem CID 133183975) has the molecular formula C32H25N3O5S and a molecular weight of 563.64 g/mol. Its IUPAC name is 2-[5-[3-[4-(4-methoxyphenoxy)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[3-[4-(4-methoxyphenoxy)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 133183975 |
| Molecular Formula | C32H25N3O5S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 2-[5-[3-[4-(4-methoxyphenoxy)phenyl]-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoic acid |
| SMILES | COc1ccc(Oc2ccc(N3C(=S)NC(c4ccccn4)C3c3ccc(-c4ccccc4C(=O)O)o3)cc2)cc1 |
| InChI | InChI=1S/C32H25N3O5S/c1-38-21-13-15-23(16-14-21)39-22-11-9-20(10-12-22)35-30(29(34-32(35)41)26-8-4-5-19-33-26)28-18-17-27(40-28)24-6-2-3-7-25(24)31(36)37/h2-19,29-30H,1H3,(H,34,41)(H,36,37) |
| InChIKey | SAYYDJKJOHNVPM-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 97.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|