C29H27N3O2S2 — CID 100608720
(4S,5R)-1-(4-cyclopentyloxyphenyl)-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100608720) has the molecular formula C29H27N3O2S2 and a molecular weight of 513.69 g/mol. Its IUPAC name is (4S,5R)-1-(4-cyclopentyloxyphenyl)-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-1-(4-cyclopentyloxyphenyl)-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100608720 |
| Molecular Formula | C29H27N3O2S2 |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | (4S,5R)-1-(4-cyclopentyloxyphenyl)-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1N[C@H](c2ccccn2)[C@H](c2ccc(Sc3ccccc3)o2)N1c1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C29H27N3O2S2/c35-29-31-27(24-12-6-7-19-30-24)28(25-17-18-26(34-25)36-23-10-2-1-3-11-23)32(29)20-13-15-22(16-14-20)33-21-8-4-5-9-21/h1-3,6-7,10-19,21,27-28H,4-5,8-9H2,(H,31,35)/t27-,28+/m1/s1 |
| InChIKey | FOGWMNZTBFRCOV-IZLXSDGUSA-N |
| XLogP | 7.32 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|