C23H23N3OS2 — CID 100603590
(4R,5R)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione (PubChem CID 100603590) has the molecular formula C23H23N3OS2 and a molecular weight of 421.59 g/mol. Its IUPAC name is (4R,5R)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100603590 |
| Molecular Formula | C23H23N3OS2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (4R,5R)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione |
| SMILES | S=C1N[C@@H](c2ccccn2)[C@H](c2cccs2)N1c1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C23H23N3OS2/c28-23-25-21(19-8-3-4-14-24-19)22(20-9-5-15-29-20)26(23)16-10-12-18(13-11-16)27-17-6-1-2-7-17/h3-5,8-15,17,21-22H,1-2,6-7H2,(H,25,28)/t21-,22-/m0/s1 |
| InChIKey | HECOVLDMSXXYOV-VXKWHMMOSA-N |
| XLogP | 5.64 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|