C29H34N4OS — CID 100607743
(4R,5S)-5-(1-cyclohexylpyrrol-2-yl)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100607743) has the molecular formula C29H34N4OS and a molecular weight of 486.69 g/mol. Its IUPAC name is (4R,5S)-5-(1-cyclohexylpyrrol-2-yl)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-5-(1-cyclohexylpyrrol-2-yl)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100607743 |
| Molecular Formula | C29H34N4OS |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | (4R,5S)-5-(1-cyclohexylpyrrol-2-yl)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1N[C@@H](c2ccccn2)[C@@H](c2cccn2C2CCCCC2)N1c1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C29H34N4OS/c35-29-31-27(25-13-6-7-19-30-25)28(26-14-8-20-32(26)21-9-2-1-3-10-21)33(29)22-15-17-24(18-16-22)34-23-11-4-5-12-23/h6-8,13-21,23,27-28H,1-5,9-12H2,(H,31,35)/t27-,28+/m0/s1 |
| InChIKey | DQKJYLQUAJBXOA-WUFINQPMSA-N |
| XLogP | 6.89 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|