C29H26ClFN4OS — CID 100604724
(4S,5S)-5-[1-(3-chloro-4-fluorophenyl)pyrrol-2-yl]-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100604724) has the molecular formula C29H26ClFN4OS and a molecular weight of 533.07 g/mol. Its IUPAC name is (4S,5S)-5-[1-(3-chloro-4-fluorophenyl)pyrrol-2-yl]-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-5-[1-(3-chloro-4-fluorophenyl)pyrrol-2-yl]-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100604724 |
| Molecular Formula | C29H26ClFN4OS |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | (4S,5S)-5-[1-(3-chloro-4-fluorophenyl)pyrrol-2-yl]-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Fc1ccc(-n2cccc2[C@@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(OC3CCCC3)cc2)cc1Cl |
| InChI | InChI=1S/C29H26ClFN4OS/c30-23-18-20(12-15-24(23)31)34-17-5-9-26(34)28-27(25-8-3-4-16-32-25)33-29(37)35(28)19-10-13-22(14-11-19)36-21-6-1-2-7-21/h3-5,8-18,21,27-28H,1-2,6-7H2,(H,33,37)/t27-,28-/m1/s1 |
| InChIKey | KRYCRGXPHPUHHY-VSGBNLITSA-N |
| XLogP | 7.16 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|