C31H33N5OS — CID 100607913
(4S,5S)-1-(4-cyclopentyloxyphenyl)-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100607913) has the molecular formula C31H33N5OS and a molecular weight of 523.71 g/mol. Its IUPAC name is (4S,5S)-1-(4-cyclopentyloxyphenyl)-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1-(4-cyclopentyloxyphenyl)-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100607913 |
| Molecular Formula | C31H33N5OS |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | (4S,5S)-1-(4-cyclopentyloxyphenyl)-5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CN(C)c1ccc(-n2cccc2[C@@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(OC3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C31H33N5OS/c1-34(2)22-12-14-23(15-13-22)35-21-7-11-28(35)30-29(27-10-5-6-20-32-27)33-31(38)36(30)24-16-18-26(19-17-24)37-25-8-3-4-9-25/h5-7,10-21,25,29-30H,3-4,8-9H2,1-2H3,(H,33,38)/t29-,30-/m1/s1 |
| InChIKey | YUPKGVCIAOWFDE-LOYHVIPDSA-N |
| XLogP | 6.44 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|