C28H29N5OS — CID 133156208
5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156208) has the molecular formula C28H29N5OS and a molecular weight of 483.64 g/mol. Its IUPAC name is 5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156208 |
| Molecular Formula | C28H29N5OS |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 5-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCOc1ccc(N2C(=S)NC(c3ccccn3)C2c2cccn2-c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H29N5OS/c1-4-34-23-16-14-22(15-17-23)33-27(26(30-28(33)35)24-8-5-6-18-29-24)25-9-7-19-32(25)21-12-10-20(11-13-21)31(2)3/h5-19,26-27H,4H2,1-3H3,(H,30,35) |
| InChIKey | YJJZSJMJOIEPRO-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|