C21H23N5S — CID 133156539
1-[4-(dimethylamino)phenyl]-5-(1-methylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156539) has the molecular formula C21H23N5S and a molecular weight of 377.52 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-5-(1-methylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[4-(dimethylamino)phenyl]-5-(1-methylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156539 |
| Molecular Formula | C21H23N5S |
| Molecular Weight | 377.52 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-5-(1-methylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CN(C)c1ccc(N2C(=S)NC(c3ccccn3)C2c2cccn2C)cc1 |
| InChI | InChI=1S/C21H23N5S/c1-24(2)15-9-11-16(12-10-15)26-20(18-8-6-14-25(18)3)19(23-21(26)27)17-7-4-5-13-22-17/h4-14,19-20H,1-3H3,(H,23,27) |
| InChIKey | KQLAEHUETWEIHV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|