C20H19BrN4S — CID 100507763
(4R,5R)-1-(4-bromo-3-methylphenyl)-5-(1-methylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100507763) has the molecular formula C20H19BrN4S and a molecular weight of 427.37 g/mol. Its IUPAC name is (4R,5R)-1-(4-bromo-3-methylphenyl)-5-(1-methylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-(4-bromo-3-methylphenyl)-5-(1-methylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100507763 |
| Molecular Formula | C20H19BrN4S |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | (4R,5R)-1-(4-bromo-3-methylphenyl)-5-(1-methylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(N2C(=S)N[C@@H](c3ccccn3)[C@@H]2c2cccn2C)ccc1Br |
| InChI | InChI=1S/C20H19BrN4S/c1-13-12-14(8-9-15(13)21)25-19(17-7-5-11-24(17)2)18(23-20(25)26)16-6-3-4-10-22-16/h3-12,18-19H,1-2H3,(H,23,26)/t18-,19-/m0/s1 |
| InChIKey | DOAYPHRPRYUPCW-OALUTQOASA-N |
| XLogP | 4.67 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|