C26H23BrN4OS — CID 100508224
(4R,5R)-1-(4-bromo-3-methylphenyl)-5-[1-(3-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100508224) has the molecular formula C26H23BrN4OS and a molecular weight of 519.47 g/mol. Its IUPAC name is (4R,5R)-1-(4-bromo-3-methylphenyl)-5-[1-(3-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-(4-bromo-3-methylphenyl)-5-[1-(3-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100508224 |
| Molecular Formula | C26H23BrN4OS |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | (4R,5R)-1-(4-bromo-3-methylphenyl)-5-[1-(3-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1cccc(-n2cccc2[C@H]2[C@H](c3ccccn3)NC(=S)N2c2ccc(Br)c(C)c2)c1 |
| InChI | InChI=1S/C26H23BrN4OS/c1-17-15-19(11-12-21(17)27)31-25(24(29-26(31)33)22-9-3-4-13-28-22)23-10-6-14-30(23)18-7-5-8-20(16-18)32-2/h3-16,24-25H,1-2H3,(H,29,33)/t24-,25-/m0/s1 |
| InChIKey | QWHKRUHYTDNNCO-DQEYMECFSA-N |
| XLogP | 6.13 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|