C24H20BrN5S — CID 100504599
(4R,5R)-1-(4-bromo-3-methylphenyl)-4-pyridin-2-yl-5-(1-pyridin-2-ylpyrrol-2-yl)imidazolidine-2-thione (PubChem CID 100504599) has the molecular formula C24H20BrN5S and a molecular weight of 490.43 g/mol. Its IUPAC name is (4R,5R)-1-(4-bromo-3-methylphenyl)-4-pyridin-2-yl-5-(1-pyridin-2-ylpyrrol-2-yl)imidazolidine-2-thione.
| Compound Name | (4R,5R)-1-(4-bromo-3-methylphenyl)-4-pyridin-2-yl-5-(1-pyridin-2-ylpyrrol-2-yl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 100504599 |
| Molecular Formula | C24H20BrN5S |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | (4R,5R)-1-(4-bromo-3-methylphenyl)-4-pyridin-2-yl-5-(1-pyridin-2-ylpyrrol-2-yl)imidazolidine-2-thione |
| SMILES | Cc1cc(N2C(=S)N[C@@H](c3ccccn3)[C@@H]2c2cccn2-c2ccccn2)ccc1Br |
| InChI | InChI=1S/C24H20BrN5S/c1-16-15-17(10-11-18(16)25)30-23(22(28-24(30)31)19-7-2-4-12-26-19)20-8-6-14-29(20)21-9-3-5-13-27-21/h2-15,22-23H,1H3,(H,28,31)/t22-,23-/m0/s1 |
| InChIKey | VZTKLKMBBKOSSH-GOTSBHOMSA-N |
| XLogP | 5.52 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|