C21H21BrN4S — CID 100505594
(4R,5S)-1-(4-bromo-3-methylphenyl)-5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100505594) has the molecular formula C21H21BrN4S and a molecular weight of 441.40 g/mol. Its IUPAC name is (4R,5S)-1-(4-bromo-3-methylphenyl)-5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-(4-bromo-3-methylphenyl)-5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100505594 |
| Molecular Formula | C21H21BrN4S |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | (4R,5S)-1-(4-bromo-3-methylphenyl)-5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(N2C(=S)N[C@@H](c3ccccn3)[C@H]2c2ccc(C)n2C)ccc1Br |
| InChI | InChI=1S/C21H21BrN4S/c1-13-12-15(8-9-16(13)22)26-20(18-10-7-14(2)25(18)3)19(24-21(26)27)17-6-4-5-11-23-17/h4-12,19-20H,1-3H3,(H,24,27)/t19-,20+/m0/s1 |
| InChIKey | YMVGAHYRSBPJMB-VQTJNVASSA-N |
| XLogP | 4.98 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|