C27H25BrN4S — CID 100508483
(4S,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100508483) has the molecular formula C27H25BrN4S and a molecular weight of 517.50 g/mol. Its IUPAC name is (4S,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100508483 |
| Molecular Formula | C27H25BrN4S |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | (4S,5S)-1-(4-bromo-3-methylphenyl)-5-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(-n2cccc2[C@@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(Br)c(C)c2)cc1C |
| InChI | InChI=1S/C27H25BrN4S/c1-17-9-10-20(15-18(17)2)31-14-6-8-24(31)26-25(23-7-4-5-13-29-23)30-27(33)32(26)21-11-12-22(28)19(3)16-21/h4-16,25-26H,1-3H3,(H,30,33)/t25-,26-/m1/s1 |
| InChIKey | GFSSHGSZNUQPOA-CLJLJLNGSA-N |
| XLogP | 6.74 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|