C27H26N4S — CID 133158232
1-(3,4-dimethylphenyl)-5-[1-(2-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133158232) has the molecular formula C27H26N4S and a molecular weight of 438.60 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-5-[1-(2-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(3,4-dimethylphenyl)-5-[1-(2-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133158232 |
| Molecular Formula | C27H26N4S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-5-[1-(2-methylphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc(N2C(=S)NC(c3ccccn3)C2c2cccn2-c2ccccc2C)cc1C |
| InChI | InChI=1S/C27H26N4S/c1-18-13-14-21(17-20(18)3)31-26(25(29-27(31)32)22-10-6-7-15-28-22)24-12-8-16-30(24)23-11-5-4-9-19(23)2/h4-17,25-26H,1-3H3,(H,29,32) |
| InChIKey | CHRCFHZHCZPITJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|