C27H23F3N4S — CID 133158235
1-(3,4-dimethylphenyl)-4-pyridin-2-yl-5-[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]imidazolidine-2-thione (PubChem CID 133158235) has the molecular formula C27H23F3N4S and a molecular weight of 492.57 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-4-pyridin-2-yl-5-[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]imidazolidine-2-thione.
| Compound Name | 1-(3,4-dimethylphenyl)-4-pyridin-2-yl-5-[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]imidazolidine-2-thione |
|---|---|
| PubChem CID | 133158235 |
| Molecular Formula | C27H23F3N4S |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-4-pyridin-2-yl-5-[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]imidazolidine-2-thione |
| SMILES | Cc1ccc(N2C(=S)NC(c3ccccn3)C2c2cccn2-c2cccc(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C27H23F3N4S/c1-17-11-12-21(15-18(17)2)34-25(24(32-26(34)35)22-9-3-4-13-31-22)23-10-6-14-33(23)20-8-5-7-19(16-20)27(28,29)30/h3-16,24-25H,1-2H3,(H,32,35) |
| InChIKey | FBAUJNUIMUAPFI-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|