C25H18F4N4S — CID 133182264
1-(4-fluorophenyl)-4-pyridin-2-yl-5-[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]imidazolidine-2-thione (PubChem CID 133182264) has the molecular formula C25H18F4N4S and a molecular weight of 482.51 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-pyridin-2-yl-5-[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]imidazolidine-2-thione.
| Compound Name | 1-(4-fluorophenyl)-4-pyridin-2-yl-5-[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]imidazolidine-2-thione |
|---|---|
| PubChem CID | 133182264 |
| Molecular Formula | C25H18F4N4S |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 1-(4-fluorophenyl)-4-pyridin-2-yl-5-[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]imidazolidine-2-thione |
| SMILES | Fc1ccc(N2C(=S)NC(c3ccccn3)C2c2cccn2-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H18F4N4S/c26-17-9-11-18(12-10-17)33-23(22(31-24(33)34)20-7-1-2-13-30-20)21-8-4-14-32(21)19-6-3-5-16(15-19)25(27,28)29/h1-15,22-23H,(H,31,34) |
| InChIKey | RJQRIKVUANEJSY-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|