C25H22N4O2S — CID 133156383
1-(4-hydroxyphenyl)-5-[1-(3-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156383) has the molecular formula C25H22N4O2S and a molecular weight of 442.54 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-5-[1-(3-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-hydroxyphenyl)-5-[1-(3-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156383 |
| Molecular Formula | C25H22N4O2S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1-(4-hydroxyphenyl)-5-[1-(3-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1cccc(-n2cccc2C2C(c3ccccn3)NC(=S)N2c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C25H22N4O2S/c1-31-20-7-4-6-18(16-20)28-15-5-9-22(28)24-23(21-8-2-3-14-26-21)27-25(32)29(24)17-10-12-19(30)13-11-17/h2-16,23-24,30H,1H3,(H,27,32) |
| InChIKey | CKJXTKHSYGGLNO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|