C27H24N4O3S — CID 133182987
methyl 4-[2-[3-(3-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]pyrrol-1-yl]benzoate (PubChem CID 133182987) has the molecular formula C27H24N4O3S and a molecular weight of 484.58 g/mol. Its IUPAC name is methyl 4-[2-[3-(3-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]pyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[2-[3-(3-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 133182987 |
| Molecular Formula | C27H24N4O3S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | methyl 4-[2-[3-(3-methoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]pyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2cccc2C2C(c3ccccn3)NC(=S)N2c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C27H24N4O3S/c1-33-21-8-5-7-20(17-21)31-25(24(29-27(31)35)22-9-3-4-15-28-22)23-10-6-16-30(23)19-13-11-18(12-14-19)26(32)34-2/h3-17,24-25H,1-2H3,(H,29,35) |
| InChIKey | XUKJEPGNPNKQPZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|