C26H26N6S — CID 133156475
1-[4-(dimethylamino)phenyl]-4-pyridin-2-yl-5-[1-(pyridin-3-ylmethyl)pyrrol-2-yl]imidazolidine-2-thione (PubChem CID 133156475) has the molecular formula C26H26N6S and a molecular weight of 454.60 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-4-pyridin-2-yl-5-[1-(pyridin-3-ylmethyl)pyrrol-2-yl]imidazolidine-2-thione.
| Compound Name | 1-[4-(dimethylamino)phenyl]-4-pyridin-2-yl-5-[1-(pyridin-3-ylmethyl)pyrrol-2-yl]imidazolidine-2-thione |
|---|---|
| PubChem CID | 133156475 |
| Molecular Formula | C26H26N6S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-4-pyridin-2-yl-5-[1-(pyridin-3-ylmethyl)pyrrol-2-yl]imidazolidine-2-thione |
| SMILES | CN(C)c1ccc(N2C(=S)NC(c3ccccn3)C2c2cccn2Cc2cccnc2)cc1 |
| InChI | InChI=1S/C26H26N6S/c1-30(2)20-10-12-21(13-11-20)32-25(24(29-26(32)33)22-8-3-4-15-28-22)23-9-6-16-31(23)18-19-7-5-14-27-17-19/h3-17,24-25H,18H2,1-2H3,(H,29,33) |
| InChIKey | PSRBTWGZUAXSAS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|