C29H29N5OS — CID 133244141
1-(4-cyclopentyloxyphenyl)-4-pyridin-2-yl-5-[1-(pyridin-3-ylmethyl)pyrrol-2-yl]imidazolidine-2-thione (PubChem CID 133244141) has the molecular formula C29H29N5OS and a molecular weight of 495.65 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-4-pyridin-2-yl-5-[1-(pyridin-3-ylmethyl)pyrrol-2-yl]imidazolidine-2-thione.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-4-pyridin-2-yl-5-[1-(pyridin-3-ylmethyl)pyrrol-2-yl]imidazolidine-2-thione |
|---|---|
| PubChem CID | 133244141 |
| Molecular Formula | C29H29N5OS |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-4-pyridin-2-yl-5-[1-(pyridin-3-ylmethyl)pyrrol-2-yl]imidazolidine-2-thione |
| SMILES | S=C1NC(c2ccccn2)C(c2cccn2Cc2cccnc2)N1c1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C29H29N5OS/c36-29-32-27(25-10-3-4-17-31-25)28(26-11-6-18-33(26)20-21-7-5-16-30-19-21)34(29)22-12-14-24(15-13-22)35-23-8-1-2-9-23/h3-7,10-19,23,27-28H,1-2,8-9,20H2,(H,32,36) |
| InChIKey | XSTGUDIZRITAMA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|