C30H30N4O2S — CID 133244217
1-(4-cyclopentyloxyphenyl)-5-[1-(4-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133244217) has the molecular formula C30H30N4O2S and a molecular weight of 510.66 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-5-[1-(4-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-5-[1-(4-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133244217 |
| Molecular Formula | C30H30N4O2S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-5-[1-(4-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(-n2cccc2C2C(c3ccccn3)NC(=S)N2c2ccc(OC3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H30N4O2S/c1-35-23-15-11-21(12-16-23)33-20-6-10-27(33)29-28(26-9-4-5-19-31-26)32-30(37)34(29)22-13-17-25(18-14-22)36-24-7-2-3-8-24/h4-6,9-20,24,28-29H,2-3,7-8H2,1H3,(H,32,37) |
| InChIKey | ULFYRZJJICTUGR-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|