C25H23ClN6S — CID 133156560
5-[1-(5-chloro-2-pyridinyl)pyrrol-2-yl]-1-[4-(dimethylamino)phenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156560) has the molecular formula C25H23ClN6S and a molecular weight of 475.02 g/mol. Its IUPAC name is 5-[1-(5-chloro-2-pyridinyl)pyrrol-2-yl]-1-[4-(dimethylamino)phenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(5-chloro-2-pyridinyl)pyrrol-2-yl]-1-[4-(dimethylamino)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156560 |
| Molecular Formula | C25H23ClN6S |
| Molecular Weight | 475.02 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 5-[1-(5-chloro-2-pyridinyl)pyrrol-2-yl]-1-[4-(dimethylamino)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CN(C)c1ccc(N2C(=S)NC(c3ccccn3)C2c2cccn2-c2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C25H23ClN6S/c1-30(2)18-9-11-19(12-10-18)32-24(23(29-25(32)33)20-6-3-4-14-27-20)21-7-5-15-31(21)22-13-8-17(26)16-28-22/h3-16,23-24H,1-2H3,(H,29,33) |
| InChIKey | FRUUMHPTEQCJAH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.02 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|