C29H30N4OS — CID 133158818
5-[1-(4-ethoxyphenyl)pyrrol-2-yl]-1-(4-propan-2-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133158818) has the molecular formula C29H30N4OS and a molecular weight of 482.65 g/mol. Its IUPAC name is 5-[1-(4-ethoxyphenyl)pyrrol-2-yl]-1-(4-propan-2-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(4-ethoxyphenyl)pyrrol-2-yl]-1-(4-propan-2-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133158818 |
| Molecular Formula | C29H30N4OS |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 5-[1-(4-ethoxyphenyl)pyrrol-2-yl]-1-(4-propan-2-ylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCOc1ccc(-n2cccc2C2C(c3ccccn3)NC(=S)N2c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H30N4OS/c1-4-34-24-16-14-22(15-17-24)32-19-7-9-26(32)28-27(25-8-5-6-18-30-25)31-29(35)33(28)23-12-10-21(11-13-23)20(2)3/h5-20,27-28H,4H2,1-3H3,(H,31,35) |
| InChIKey | YXMXVUBUUKPVRU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|