C32H27N5O3S2 — CID 133178086
5-[1-(4-ethoxyphenyl)pyrrol-2-yl]-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133178086) has the molecular formula C32H27N5O3S2 and a molecular weight of 593.73 g/mol. Its IUPAC name is 5-[1-(4-ethoxyphenyl)pyrrol-2-yl]-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(4-ethoxyphenyl)pyrrol-2-yl]-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133178086 |
| Molecular Formula | C32H27N5O3S2 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | 5-[1-(4-ethoxyphenyl)pyrrol-2-yl]-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCOc1ccc(-n2cccc2C2C(c3ccccn3)NC(=S)N2c2ccc(Sc3ccc([N+](=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C32H27N5O3S2/c1-2-40-25-14-8-22(9-15-25)35-21-5-7-29(35)31-30(28-6-3-4-20-33-28)34-32(41)36(31)23-10-16-26(17-11-23)42-27-18-12-24(13-19-27)37(38)39/h3-21,30-31H,2H2,1H3,(H,34,41) |
| InChIKey | WPWCFXKSKJSNSR-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|