C31H25N5O3S2 — CID 133184043
5-[1-(2-methoxyphenyl)pyrrol-2-yl]-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133184043) has the molecular formula C31H25N5O3S2 and a molecular weight of 579.71 g/mol. Its IUPAC name is 5-[1-(2-methoxyphenyl)pyrrol-2-yl]-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(2-methoxyphenyl)pyrrol-2-yl]-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133184043 |
| Molecular Formula | C31H25N5O3S2 |
| Molecular Weight | 579.71 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | 5-[1-(2-methoxyphenyl)pyrrol-2-yl]-1-[4-(4-nitrophenyl)sulfanylphenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccccc1-n1cccc1C1C(c2ccccn2)NC(=S)N1c1ccc(Sc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C31H25N5O3S2/c1-39-28-10-3-2-8-26(28)34-20-6-9-27(34)30-29(25-7-4-5-19-32-25)33-31(40)35(30)21-11-15-23(16-12-21)41-24-17-13-22(14-18-24)36(37)38/h2-20,29-30H,1H3,(H,33,40) |
| InChIKey | ZFKAXKTZIKPUMH-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.71 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|