C31H38N4OS — CID 100605600
(4S,5S)-5-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100605600) has the molecular formula C31H38N4OS and a molecular weight of 514.74 g/mol. Its IUPAC name is (4S,5S)-5-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-5-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100605600 |
| Molecular Formula | C31H38N4OS |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | (4S,5S)-5-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)-1-(4-cyclopentyloxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc([C@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(OC3CCCC3)cc2)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C31H38N4OS/c1-21-20-27(22(2)34(21)23-10-4-3-5-11-23)30-29(28-14-8-9-19-32-28)33-31(37)35(30)24-15-17-26(18-16-24)36-25-12-6-7-13-25/h8-9,14-20,23,25,29-30H,3-7,10-13H2,1-2H3,(H,33,37)/t29-,30+/m1/s1 |
| InChIKey | DRQWPBSAOBDUDG-IHLOFXLRSA-N |
| XLogP | 7.50 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|