C31H33N5OS — CID 133244202
1-(4-cyclopentyloxyphenyl)-5-[2,5-dimethyl-1-(3-methyl-2-pyridinyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133244202) has the molecular formula C31H33N5OS and a molecular weight of 523.71 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-5-[2,5-dimethyl-1-(3-methyl-2-pyridinyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-5-[2,5-dimethyl-1-(3-methyl-2-pyridinyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133244202 |
| Molecular Formula | C31H33N5OS |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-5-[2,5-dimethyl-1-(3-methyl-2-pyridinyl)pyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cccnc1-n1c(C)cc(C2C(c3ccccn3)NC(=S)N2c2ccc(OC3CCCC3)cc2)c1C |
| InChI | InChI=1S/C31H33N5OS/c1-20-9-8-18-33-30(20)35-21(2)19-26(22(35)3)29-28(27-12-6-7-17-32-27)34-31(38)36(29)23-13-15-25(16-14-23)37-24-10-4-5-11-24/h6-9,12-19,24,28-29H,4-5,10-11H2,1-3H3,(H,34,38) |
| InChIKey | ZDDYJJUYEVWVCC-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|