C25H27FN4S — CID 100501752
(4S,5S)-5-(1-cyclohexylpyrrol-2-yl)-1-(4-fluoro-3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100501752) has the molecular formula C25H27FN4S and a molecular weight of 434.58 g/mol. Its IUPAC name is (4S,5S)-5-(1-cyclohexylpyrrol-2-yl)-1-(4-fluoro-3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-5-(1-cyclohexylpyrrol-2-yl)-1-(4-fluoro-3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100501752 |
| Molecular Formula | C25H27FN4S |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (4S,5S)-5-(1-cyclohexylpyrrol-2-yl)-1-(4-fluoro-3-methylphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc(N2C(=S)N[C@H](c3ccccn3)[C@H]2c2cccn2C2CCCCC2)ccc1F |
| InChI | InChI=1S/C25H27FN4S/c1-17-16-19(12-13-20(17)26)30-24(23(28-25(30)31)21-10-5-6-14-27-21)22-11-7-15-29(22)18-8-3-2-4-9-18/h5-7,10-16,18,23-24H,2-4,8-9H2,1H3,(H,28,31)/t23-,24-/m1/s1 |
| InChIKey | MWWXBSOMWCNZEA-DNQXCXABSA-N |
| XLogP | 6.01 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|