C29H26N4O4S — CID 100608930
(4S,5R)-1-(4-cyclopentyloxyphenyl)-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100608930) has the molecular formula C29H26N4O4S and a molecular weight of 526.62 g/mol. Its IUPAC name is (4S,5R)-1-(4-cyclopentyloxyphenyl)-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-1-(4-cyclopentyloxyphenyl)-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100608930 |
| Molecular Formula | C29H26N4O4S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | (4S,5R)-1-(4-cyclopentyloxyphenyl)-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccc([C@H]2[C@@H](c3ccccn3)NC(=S)N2c2ccc(OC3CCCC3)cc2)o1 |
| InChI | InChI=1S/C29H26N4O4S/c34-33(35)24-11-4-3-9-22(24)25-16-17-26(37-25)28-27(23-10-5-6-18-30-23)31-29(38)32(28)19-12-14-21(15-13-19)36-20-7-1-2-8-20/h3-6,9-18,20,27-28H,1-2,7-8H2,(H,31,38)/t27-,28+/m1/s1 |
| InChIKey | GDCGRAYAFBNROG-IZLXSDGUSA-N |
| XLogP | 6.75 |
| TPSA | 93.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|