C31H24N4O4S — CID 133183631
1-[4-(2-methylphenoxy)phenyl]-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183631) has the molecular formula C31H24N4O4S and a molecular weight of 548.62 g/mol. Its IUPAC name is 1-[4-(2-methylphenoxy)phenyl]-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-[4-(2-methylphenoxy)phenyl]-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183631 |
| Molecular Formula | C31H24N4O4S |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 1-[4-(2-methylphenoxy)phenyl]-5-[5-(2-nitrophenyl)furan-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccccc1Oc1ccc(N2C(=S)NC(c3ccccn3)C2c2ccc(-c3ccccc3[N+](=O)[O-])o2)cc1 |
| InChI | InChI=1S/C31H24N4O4S/c1-20-8-2-5-12-26(20)38-22-15-13-21(14-16-22)34-30(29(33-31(34)40)24-10-6-7-19-32-24)28-18-17-27(39-28)23-9-3-4-11-25(23)35(36)37/h2-19,29-30H,1H3,(H,33,40) |
| InChIKey | FKXGHFKMLZOPSJ-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 93.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|