C26H23N5OS — CID 133156885
N-[4-[5-(1-phenylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide (PubChem CID 133156885) has the molecular formula C26H23N5OS and a molecular weight of 453.57 g/mol. Its IUPAC name is N-[4-[5-(1-phenylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[5-(1-phenylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 133156885 |
| Molecular Formula | C26H23N5OS |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-[4-[5-(1-phenylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=S)NC(c3ccccn3)C2c2cccn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N5OS/c1-18(32)28-19-12-14-21(15-13-19)31-25(24(29-26(31)33)22-10-5-6-16-27-22)23-11-7-17-30(23)20-8-3-2-4-9-20/h2-17,24-25H,1H3,(H,28,32)(H,29,33) |
| InChIKey | CFZWLASYNBBXQS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|